2-methoxycarbonylpyridine-4-carboxylic acid

C8H7NO4 — CID 18753310

IUPAC2-methoxycarbonylpyridine-4-carboxylic acid
SMILESCOC(=O)c1cc(C(=O)O)ccn1
InChIInChI=1S/C8H7NO4/c1-13-8(12)6-4-5(7(10)11)2-3-9-6/h2-4H,1H3,(H,10,11)
InChIKeyMAFJOMAYYKSZOS-UHFFFAOYSA-N
MW181.15 g/mol
LogP0.57
Rot. Bonds2

About 2-methoxycarbonylpyridine-4-carboxylic acid

2-methoxycarbonylpyridine-4-carboxylic acid (PubChem CID 18753310) has the molecular formula C8H7NO4 and a molecular weight of 181.15 g/mol. Its IUPAC name is 2-methoxycarbonylpyridine-4-carboxylic acid.

Molecular Properties

Compound Name2-methoxycarbonylpyridine-4-carboxylic acid
PubChem CID18753310
Molecular FormulaC8H7NO4
Molecular Weight181.15 g/mol
Exact Mass181.04
IUPAC Name2-methoxycarbonylpyridine-4-carboxylic acid
SMILESCOC(=O)c1cc(C(=O)O)ccn1
InChIInChI=1S/C8H7NO4/c1-13-8(12)6-4-5(7(10)11)2-3-9-6/h2-4H,1H3,(H,10,11)
InChIKeyMAFJOMAYYKSZOS-UHFFFAOYSA-N
XLogP0.57
TPSA76.49 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500181.15
LogP ≤ 50.57
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-methoxycarbonylpyridine-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methoxycarbonylpyridine-4-carboxylic acid?
The IUPAC name of 2-methoxycarbonylpyridine-4-carboxylic acid (CID 18753310) is 2-methoxycarbonylpyridine-4-carboxylic acid.
What is the SMILES notation for 2-methoxycarbonylpyridine-4-carboxylic acid?
The canonical SMILES for 2-methoxycarbonylpyridine-4-carboxylic acid is COC(=O)c1cc(C(=O)O)ccn1.
What is the InChIKey of 2-methoxycarbonylpyridine-4-carboxylic acid?
The InChIKey is MAFJOMAYYKSZOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO4/c1-13-8(12)6-4-5(7(10)11)2-3-9-6/h2-4H,1H3,(H,10,11).
What are the key properties of 2-methoxycarbonylpyridine-4-carboxylic acid?
2-methoxycarbonylpyridine-4-carboxylic acid has a molecular weight of 181.15 g/mol, XLogP of 0.57, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxycarbonylpyridine-4-carboxylic acid is sourced from PubChem (CID 18753310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).