C17H23N3O3 — CID 18754129
5-[3-(3-methylpiperidin-1-yl)propoxy]-1H-pyrrolo[3,2-b]pyridine-3-carboxylic acid (PubChem CID 18754129) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is 5-[3-(3-methylpiperidin-1-yl)propoxy]-1H-pyrrolo[3,2-b]pyridine-3-carboxylic acid.
| Compound Name | 5-[3-(3-methylpiperidin-1-yl)propoxy]-1H-pyrrolo[3,2-b]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 18754129 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 5-[3-(3-methylpiperidin-1-yl)propoxy]-1H-pyrrolo[3,2-b]pyridine-3-carboxylic acid |
| SMILES | CC1CCCN(CCCOc2ccc3[nH]cc(C(=O)O)c3n2)C1 |
| InChI | InChI=1S/C17H23N3O3/c1-12-4-2-7-20(11-12)8-3-9-23-15-6-5-14-16(19-15)13(10-18-14)17(21)22/h5-6,10,12,18H,2-4,7-9,11H2,1H3,(H,21,22) |
| InChIKey | AXUJXNCBXGMGHT-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 78.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|