C17H22BrN3O6S — CID 18754959
N-[3-bromo-4-[(3,4-dimethyl-1,2-oxazol-5-yl)-(1-methoxyethoxymethyl)sulfamoyl]phenyl]acetamide (PubChem CID 18754959) has the molecular formula C17H22BrN3O6S and a molecular weight of 476.35 g/mol. Its IUPAC name is N-[3-bromo-4-[(3,4-dimethyl-1,2-oxazol-5-yl)-(1-methoxyethoxymethyl)sulfamoyl]phenyl]acetamide.
| Compound Name | N-[3-bromo-4-[(3,4-dimethyl-1,2-oxazol-5-yl)-(1-methoxyethoxymethyl)sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 18754959 |
| Molecular Formula | C17H22BrN3O6S |
| Molecular Weight | 476.35 g/mol |
| Exact Mass | 475.04 |
| IUPAC Name | N-[3-bromo-4-[(3,4-dimethyl-1,2-oxazol-5-yl)-(1-methoxyethoxymethyl)sulfamoyl]phenyl]acetamide |
| SMILES | COC(C)OCN(c1onc(C)c1C)S(=O)(=O)c1ccc(NC(C)=O)cc1Br |
| InChI | InChI=1S/C17H22BrN3O6S/c1-10-11(2)20-27-17(10)21(9-26-13(4)25-5)28(23,24)16-7-6-14(8-15(16)18)19-12(3)22/h6-8,13H,9H2,1-5H3,(H,19,22) |
| InChIKey | FJWLOMKOIQRFEE-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 110.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|