C20H25NO3 — CID 18756011
2-(3,16,17-trihydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl)acetonitrile (PubChem CID 18756011) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is 2-(3,16,17-trihydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl)acetonitrile.
| Compound Name | 2-(3,16,17-trihydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl)acetonitrile |
|---|---|
| PubChem CID | 18756011 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | 2-(3,16,17-trihydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl)acetonitrile |
| SMILES | CC12CCC3c4ccc(O)cc4CCC3C1CC(O)C2(O)CC#N |
| InChI | InChI=1S/C20H25NO3/c1-19-7-6-15-14-5-3-13(22)10-12(14)2-4-16(15)17(19)11-18(23)20(19,24)8-9-21/h3,5,10,15-18,22-24H,2,4,6-8,11H2,1H3 |
| InChIKey | KPJWUAPHYRWMOI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |