C11H20N3O3P — CID 18757002
(1,4-diamino-4-methyl-1-pyridin-3-ylpentan-2-yl)phosphonic acid (PubChem CID 18757002) has the molecular formula C11H20N3O3P and a molecular weight of 273.27 g/mol. Its IUPAC name is (1,4-diamino-4-methyl-1-pyridin-3-ylpentan-2-yl)phosphonic acid.
| Compound Name | (1,4-diamino-4-methyl-1-pyridin-3-ylpentan-2-yl)phosphonic acid |
|---|---|
| PubChem CID | 18757002 |
| Molecular Formula | C11H20N3O3P |
| Molecular Weight | 273.27 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | (1,4-diamino-4-methyl-1-pyridin-3-ylpentan-2-yl)phosphonic acid |
| SMILES | CC(C)(N)CC(C(N)c1cccnc1)P(=O)(O)O |
| InChI | InChI=1S/C11H20N3O3P/c1-11(2,13)6-9(18(15,16)17)10(12)8-4-3-5-14-7-8/h3-5,7,9-10H,6,12-13H2,1-2H3,(H2,15,16,17) |
| InChIKey | HXWDIYSFZWQXBZ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 122.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.27 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|