C30H34FN3O5 — CID 18758566
3-[[2-[3-[[4-[2-(2-fluorophenyl)ethynyl]phenyl]methyl]-4,4-dimethyl-2,5-dioxoimidazolidin-1-yl]-4-methylpentanoyl]amino]butanoic acid (PubChem CID 18758566) has the molecular formula C30H34FN3O5 and a molecular weight of 535.62 g/mol. Its IUPAC name is 3-[[2-[3-[[4-[2-(2-fluorophenyl)ethynyl]phenyl]methyl]-4,4-dimethyl-2,5-dioxoimidazolidin-1-yl]-4-methylpentanoyl]amino]butanoic acid.
| Compound Name | 3-[[2-[3-[[4-[2-(2-fluorophenyl)ethynyl]phenyl]methyl]-4,4-dimethyl-2,5-dioxoimidazolidin-1-yl]-4-methylpentanoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 18758566 |
| Molecular Formula | C30H34FN3O5 |
| Molecular Weight | 535.62 g/mol |
| Exact Mass | 535.25 |
| IUPAC Name | 3-[[2-[3-[[4-[2-(2-fluorophenyl)ethynyl]phenyl]methyl]-4,4-dimethyl-2,5-dioxoimidazolidin-1-yl]-4-methylpentanoyl]amino]butanoic acid |
| SMILES | CC(C)CC(C(=O)NC(C)CC(=O)O)N1C(=O)N(Cc2ccc(C#Cc3ccccc3F)cc2)C(C)(C)C1=O |
| InChI | InChI=1S/C30H34FN3O5/c1-19(2)16-25(27(37)32-20(3)17-26(35)36)34-28(38)30(4,5)33(29(34)39)18-22-12-10-21(11-13-22)14-15-23-8-6-7-9-24(23)31/h6-13,19-20,25H,16-18H2,1-5H3,(H,32,37)(H,35,36) |
| InChIKey | RGRWBJYKIJIFCR-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.62 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|