C30H37N3O5 — CID 135550511
(3R)-3-[[(2R)-2-[4,4-dimethyl-2,5-dioxo-3-[[4-[(E)-2-phenylethenyl]phenyl]methyl]imidazolidin-1-yl]-4-methylpentanoyl]amino]butanoic acid (PubChem CID 135550511) has the molecular formula C30H37N3O5 and a molecular weight of 519.64 g/mol. Its IUPAC name is (3R)-3-[[(2R)-2-[4,4-dimethyl-2,5-dioxo-3-[[4-[(E)-2-phenylethenyl]phenyl]methyl]imidazolidin-1-yl]-4-methylpentanoyl]amino]butanoic acid.
| Compound Name | (3R)-3-[[(2R)-2-[4,4-dimethyl-2,5-dioxo-3-[[4-[(E)-2-phenylethenyl]phenyl]methyl]imidazolidin-1-yl]-4-methylpentanoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 135550511 |
| Molecular Formula | C30H37N3O5 |
| Molecular Weight | 519.64 g/mol |
| Exact Mass | 519.27 |
| IUPAC Name | (3R)-3-[[(2R)-2-[4,4-dimethyl-2,5-dioxo-3-[[4-[(E)-2-phenylethenyl]phenyl]methyl]imidazolidin-1-yl]-4-methylpentanoyl]amino]butanoic acid |
| SMILES | CC(C)C[C@H](C(=O)N[C@H](C)CC(=O)O)N1C(=O)N(Cc2ccc(/C=C/c3ccccc3)cc2)C(C)(C)C1=O |
| InChI | InChI=1S/C30H37N3O5/c1-20(2)17-25(27(36)31-21(3)18-26(34)35)33-28(37)30(4,5)32(29(33)38)19-24-15-13-23(14-16-24)12-11-22-9-7-6-8-10-22/h6-16,20-21,25H,17-19H2,1-5H3,(H,31,36)(H,34,35)/b12-11+/t21-,25-/m1/s1 |
| InChIKey | JQSPOZCLQBCORI-NVSQWWMQSA-N |
| XLogP | 4.79 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.64 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|