About 2-(thiiran-2-ylmethylselanylmethylselanylmethyl)thiirane
2-(thiiran-2-ylmethylselanylmethylselanylmethyl)thiirane (PubChem CID 18760616) has the molecular formula C7H12S2Se2
and a molecular weight of 318.23 g/mol. Its IUPAC name is 2-(thiiran-2-ylmethylselanylmethylselanylmethyl)thiirane.
Molecular Properties
| Compound Name | 2-(thiiran-2-ylmethylselanylmethylselanylmethyl)thiirane |
| PubChem CID | 18760616 |
| Molecular Formula | C7H12S2Se2 |
| Molecular Weight | 318.23 g/mol |
| Exact Mass | 319.87 |
| IUPAC Name | 2-(thiiran-2-ylmethylselanylmethylselanylmethyl)thiirane |
| SMILES | C([Se]CC1CS1)[Se]CC1CS1 |
| InChI | InChI=1S/C7H12S2Se2/c1-6(8-1)3-10-5-11-4-7-2-9-7/h6-7H,1-5H2 |
| InChIKey | NAOJWQWQRHNYGW-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.23 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(thiiran-2-ylmethylselanylmethylselanylmethyl)thiirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(thiiran-2-ylmethylselanylmethylselanylmethyl)thiirane?
The IUPAC name of 2-(thiiran-2-ylmethylselanylmethylselanylmethyl)thiirane (CID 18760616) is 2-(thiiran-2-ylmethylselanylmethylselanylmethyl)thiirane.
What is the SMILES notation for 2-(thiiran-2-ylmethylselanylmethylselanylmethyl)thiirane?
The canonical SMILES for 2-(thiiran-2-ylmethylselanylmethylselanylmethyl)thiirane is C([Se]CC1CS1)[Se]CC1CS1.
What is the InChIKey of 2-(thiiran-2-ylmethylselanylmethylselanylmethyl)thiirane?
The InChIKey is NAOJWQWQRHNYGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12S2Se2/c1-6(8-1)3-10-5-11-4-7-2-9-7/h6-7H,1-5H2.
What are the key properties of 2-(thiiran-2-ylmethylselanylmethylselanylmethyl)thiirane?
2-(thiiran-2-ylmethylselanylmethylselanylmethyl)thiirane has a molecular weight of 318.23 g/mol, XLogP of 1.84, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(thiiran-2-ylmethylselanylmethylselanylmethyl)thiirane is sourced from PubChem (CID 18760616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).