C17H28NO7P — CID 18761556
ethyl 6-(1-diethoxyphosphoryl-3,3-dimethoxypropyl)pyridine-3-carboxylate (PubChem CID 18761556) has the molecular formula C17H28NO7P and a molecular weight of 389.39 g/mol. Its IUPAC name is ethyl 6-(1-diethoxyphosphoryl-3,3-dimethoxypropyl)pyridine-3-carboxylate.
| Compound Name | ethyl 6-(1-diethoxyphosphoryl-3,3-dimethoxypropyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 18761556 |
| Molecular Formula | C17H28NO7P |
| Molecular Weight | 389.39 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | ethyl 6-(1-diethoxyphosphoryl-3,3-dimethoxypropyl)pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(C(CC(OC)OC)P(=O)(OCC)OCC)nc1 |
| InChI | InChI=1S/C17H28NO7P/c1-6-23-17(19)13-9-10-14(18-12-13)15(11-16(21-4)22-5)26(20,24-7-2)25-8-3/h9-10,12,15-16H,6-8,11H2,1-5H3 |
| InChIKey | WKYKTOKPCSFAIQ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 93.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.39 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|