C6H14N2 — CID 18761762
N,N-dimethylpyrrolidin-2-amine (PubChem CID 18761762) has the molecular formula C6H14N2 and a molecular weight of 114.19 g/mol. Its IUPAC name is N,N-dimethylpyrrolidin-2-amine.
| Compound Name | N,N-dimethylpyrrolidin-2-amine |
|---|---|
| PubChem CID | 18761762 |
| Molecular Formula | C6H14N2 |
| Molecular Weight | 114.19 g/mol |
| Exact Mass | 114.12 |
| IUPAC Name | N,N-dimethylpyrrolidin-2-amine |
| SMILES | CN(C)C1CCCN1 |
| InChI | InChI=1S/C6H14N2/c1-8(2)6-4-3-5-7-6/h6-7H,3-5H2,1-2H3 |
| InChIKey | BAURESMSGSEGPQ-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.19 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |