C7H17N3 — CID 68769728
N'-methyl-N'-pyrrolidin-2-ylethane-1,2-diamine (PubChem CID 68769728) has the molecular formula C7H17N3 and a molecular weight of 143.23 g/mol. Its IUPAC name is N'-methyl-N'-pyrrolidin-2-ylethane-1,2-diamine.
| Compound Name | N'-methyl-N'-pyrrolidin-2-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 68769728 |
| Molecular Formula | C7H17N3 |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.14 |
| IUPAC Name | N'-methyl-N'-pyrrolidin-2-ylethane-1,2-diamine |
| SMILES | CN(CCN)C1CCCN1 |
| InChI | InChI=1S/C7H17N3/c1-10(6-4-8)7-3-2-5-9-7/h7,9H,2-6,8H2,1H3 |
| InChIKey | LROCHQHWTZBGFK-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |