C15H23ClF3N3O2 — CID 18766197
N'-[3-(tert-butylamino)-2-hydroxypropoxy]-3-(trifluoromethyl)benzenecarboximidamide;hydrochloride (PubChem CID 18766197) has the molecular formula C15H23ClF3N3O2 and a molecular weight of 369.82 g/mol. Its IUPAC name is N'-[3-(tert-butylamino)-2-hydroxypropoxy]-3-(trifluoromethyl)benzenecarboximidamide;hydrochloride.
| Compound Name | N'-[3-(tert-butylamino)-2-hydroxypropoxy]-3-(trifluoromethyl)benzenecarboximidamide;hydrochloride |
|---|---|
| PubChem CID | 18766197 |
| Molecular Formula | C15H23ClF3N3O2 |
| Molecular Weight | 369.82 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | N'-[3-(tert-butylamino)-2-hydroxypropoxy]-3-(trifluoromethyl)benzenecarboximidamide;hydrochloride |
| SMILES | CC(C)(C)NCC(O)CO/N=C(\N)c1cccc(C(F)(F)F)c1.Cl |
| InChI | InChI=1S/C15H22F3N3O2.ClH/c1-14(2,3)20-8-12(22)9-23-21-13(19)10-5-4-6-11(7-10)15(16,17)18;/h4-7,12,20,22H,8-9H2,1-3H3,(H2,19,21);1H |
| InChIKey | XSTWNXNXMODAHO-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 79.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.82 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|