C17H22ClF3N2O2 — CID 73462285
N-[3-(cyclohexylamino)-2-hydroxypropoxy]-3-(trifluoromethyl)benzenecarboximidoyl chloride (PubChem CID 73462285) has the molecular formula C17H22ClF3N2O2 and a molecular weight of 378.82 g/mol. Its IUPAC name is N-[3-(cyclohexylamino)-2-hydroxypropoxy]-3-(trifluoromethyl)benzenecarboximidoyl chloride.
| Compound Name | N-[3-(cyclohexylamino)-2-hydroxypropoxy]-3-(trifluoromethyl)benzenecarboximidoyl chloride |
|---|---|
| PubChem CID | 73462285 |
| Molecular Formula | C17H22ClF3N2O2 |
| Molecular Weight | 378.82 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | N-[3-(cyclohexylamino)-2-hydroxypropoxy]-3-(trifluoromethyl)benzenecarboximidoyl chloride |
| SMILES | OC(CNC1CCCCC1)CON=C(Cl)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H22ClF3N2O2/c18-16(12-5-4-6-13(9-12)17(19,20)21)23-25-11-15(24)10-22-14-7-2-1-3-8-14/h4-6,9,14-15,22,24H,1-3,7-8,10-11H2 |
| InChIKey | OTFJQGZEKBOFSO-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.82 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|