C22H24ClNO — CID 18767247
2-benzyl-3-(dimethylamino)-1-naphthalen-2-ylpropan-1-one;hydrochloride (PubChem CID 18767247) has the molecular formula C22H24ClNO and a molecular weight of 353.89 g/mol. Its IUPAC name is 2-benzyl-3-(dimethylamino)-1-naphthalen-2-ylpropan-1-one;hydrochloride.
| Compound Name | 2-benzyl-3-(dimethylamino)-1-naphthalen-2-ylpropan-1-one;hydrochloride |
|---|---|
| PubChem CID | 18767247 |
| Molecular Formula | C22H24ClNO |
| Molecular Weight | 353.89 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | 2-benzyl-3-(dimethylamino)-1-naphthalen-2-ylpropan-1-one;hydrochloride |
| SMILES | CN(C)CC(Cc1ccccc1)C(=O)c1ccc2ccccc2c1.Cl |
| InChI | InChI=1S/C22H23NO.ClH/c1-23(2)16-21(14-17-8-4-3-5-9-17)22(24)20-13-12-18-10-6-7-11-19(18)15-20;/h3-13,15,21H,14,16H2,1-2H3;1H |
| InChIKey | ZWCJBIXSKQGQSZ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.89 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |