C21H23N — CID 67203789
N,N-dimethyl-2-naphthalen-2-yl-3-phenylpropan-1-amine (PubChem CID 67203789) has the molecular formula C21H23N and a molecular weight of 289.42 g/mol. Its IUPAC name is N,N-dimethyl-2-naphthalen-2-yl-3-phenylpropan-1-amine.
| Compound Name | N,N-dimethyl-2-naphthalen-2-yl-3-phenylpropan-1-amine |
|---|---|
| PubChem CID | 67203789 |
| Molecular Formula | C21H23N |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | N,N-dimethyl-2-naphthalen-2-yl-3-phenylpropan-1-amine |
| SMILES | CN(C)CC(Cc1ccccc1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H23N/c1-22(2)16-21(14-17-8-4-3-5-9-17)20-13-12-18-10-6-7-11-19(18)15-20/h3-13,15,21H,14,16H2,1-2H3 |
| InChIKey | CHQHUGOLBOTCRQ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |