C32H36NO6- — CID 18770215
1-[4-[4-[7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrochromen-4-yl]phenoxy]butyl]piperidine-2-carboxylate (PubChem CID 18770215) has the molecular formula C32H36NO6- and a molecular weight of 530.64 g/mol. Its IUPAC name is 1-[4-[4-[7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrochromen-4-yl]phenoxy]butyl]piperidine-2-carboxylate.
| Compound Name | 1-[4-[4-[7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrochromen-4-yl]phenoxy]butyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 18770215 |
| Molecular Formula | C32H36NO6- |
| Molecular Weight | 530.64 g/mol |
| Exact Mass | 530.25 |
| IUPAC Name | 1-[4-[4-[7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrochromen-4-yl]phenoxy]butyl]piperidine-2-carboxylate |
| SMILES | CC1(c2ccc(O)cc2)COc2cc(O)ccc2C1c1ccc(OCCCCN2CCCCC2C(=O)[O-])cc1 |
| InChI | InChI=1S/C32H37NO6/c1-32(23-9-11-24(34)12-10-23)21-39-29-20-25(35)13-16-27(29)30(32)22-7-14-26(15-8-22)38-19-5-4-18-33-17-3-2-6-28(33)31(36)37/h7-16,20,28,30,34-35H,2-6,17-19,21H2,1H3,(H,36,37)/p-1 |
| InChIKey | GFQNEGMKCGZQPZ-UHFFFAOYSA-M |
| XLogP | 4.34 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.64 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|