C29H37NO4 — CID 142952789
(4S)-4-methyl-3,4-dihydro-2H-chromen-7-ol;phenol;1-(2-phenoxyethyl)piperidine (PubChem CID 142952789) has the molecular formula C29H37NO4 and a molecular weight of 463.62 g/mol. Its IUPAC name is (4S)-4-methyl-3,4-dihydro-2H-chromen-7-ol;phenol;1-(2-phenoxyethyl)piperidine.
| Compound Name | (4S)-4-methyl-3,4-dihydro-2H-chromen-7-ol;phenol;1-(2-phenoxyethyl)piperidine |
|---|---|
| PubChem CID | 142952789 |
| Molecular Formula | C29H37NO4 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.27 |
| IUPAC Name | (4S)-4-methyl-3,4-dihydro-2H-chromen-7-ol;phenol;1-(2-phenoxyethyl)piperidine |
| SMILES | C[C@H]1CCOc2cc(O)ccc21.Oc1ccccc1.c1ccc(OCCN2CCCCC2)cc1 |
| InChI | InChI=1S/C13H19NO.C10H12O2.C6H6O/c1-3-7-13(8-4-1)15-12-11-14-9-5-2-6-10-14;1-7-4-5-12-10-6-8(11)2-3-9(7)10;7-6-4-2-1-3-5-6/h1,3-4,7-8H,2,5-6,9-12H2;2-3,6-7,11H,4-5H2,1H3;1-5,7H/t;7-;/m.0./s1 |
| InChIKey | KGHOVHLEKAYRAC-IXSARBFQSA-N |
| XLogP | 6.22 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |