C29H41NO3S — CID 142137642
3-cyclooctyl-2,3-dihydro-1,4-benzoxathiin-7-ol;1-(2-phenoxyethyl)piperidine (PubChem CID 142137642) has the molecular formula C29H41NO3S and a molecular weight of 483.72 g/mol. Its IUPAC name is 3-cyclooctyl-2,3-dihydro-1,4-benzoxathiin-7-ol;1-(2-phenoxyethyl)piperidine.
| Compound Name | 3-cyclooctyl-2,3-dihydro-1,4-benzoxathiin-7-ol;1-(2-phenoxyethyl)piperidine |
|---|---|
| PubChem CID | 142137642 |
| Molecular Formula | C29H41NO3S |
| Molecular Weight | 483.72 g/mol |
| Exact Mass | 483.28 |
| IUPAC Name | 3-cyclooctyl-2,3-dihydro-1,4-benzoxathiin-7-ol;1-(2-phenoxyethyl)piperidine |
| SMILES | Oc1ccc2c(c1)OCC(C1CCCCCCC1)S2.c1ccc(OCCN2CCCCC2)cc1 |
| InChI | InChI=1S/C16H22O2S.C13H19NO/c17-13-8-9-15-14(10-13)18-11-16(19-15)12-6-4-2-1-3-5-7-12;1-3-7-13(8-4-1)15-12-11-14-9-5-2-6-10-14/h8-10,12,16-17H,1-7,11H2;1,3-4,7-8H,2,5-6,9-12H2 |
| InChIKey | MRPITMQDDXAKJP-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.72 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |