About 2-[7-fluoro-4-(4-methylphenyl)spiro[chromene-2,4'-piperidine]-1'-yl]acetic acid
2-[7-fluoro-4-(4-methylphenyl)spiro[chromene-2,4'-piperidine]-1'-yl]acetic acid (PubChem CID 18770941) has the molecular formula C22H22FNO3
and a molecular weight of 367.42 g/mol. Its IUPAC name is 2-[7-fluoro-4-(4-methylphenyl)spiro[chromene-2,4'-piperidine]-1'-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[7-fluoro-4-(4-methylphenyl)spiro[chromene-2,4'-piperidine]-1'-yl]acetic acid |
| PubChem CID | 18770941 |
| Molecular Formula | C22H22FNO3 |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 2-[7-fluoro-4-(4-methylphenyl)spiro[chromene-2,4'-piperidine]-1'-yl]acetic acid |
| SMILES | Cc1ccc(C2=CC3(CCN(CC(=O)O)CC3)Oc3cc(F)ccc32)cc1 |
| InChI | InChI=1S/C22H22FNO3/c1-15-2-4-16(5-3-15)19-13-22(8-10-24(11-9-22)14-21(25)26)27-20-12-17(23)6-7-18(19)20/h2-7,12-13H,8-11,14H2,1H3,(H,25,26) |
| InChIKey | SXETYZVCZDNXAQ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[7-fluoro-4-(4-methylphenyl)spiro[chromene-2,4'-piperidine]-1'-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[7-fluoro-4-(4-methylphenyl)spiro[chromene-2,4'-piperidine]-1'-yl]acetic acid?
The IUPAC name of 2-[7-fluoro-4-(4-methylphenyl)spiro[chromene-2,4'-piperidine]-1'-yl]acetic acid (CID 18770941) is 2-[7-fluoro-4-(4-methylphenyl)spiro[chromene-2,4'-piperidine]-1'-yl]acetic acid.
What is the SMILES notation for 2-[7-fluoro-4-(4-methylphenyl)spiro[chromene-2,4'-piperidine]-1'-yl]acetic acid?
The canonical SMILES for 2-[7-fluoro-4-(4-methylphenyl)spiro[chromene-2,4'-piperidine]-1'-yl]acetic acid is Cc1ccc(C2=CC3(CCN(CC(=O)O)CC3)Oc3cc(F)ccc32)cc1.
What is the InChIKey of 2-[7-fluoro-4-(4-methylphenyl)spiro[chromene-2,4'-piperidine]-1'-yl]acetic acid?
The InChIKey is SXETYZVCZDNXAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22FNO3/c1-15-2-4-16(5-3-15)19-13-22(8-10-24(11-9-22)14-21(25)26)27-20-12-17(23)6-7-18(19)20/h2-7,12-13H,8-11,14H2,1H3,(H,25,26).
What are the key properties of 2-[7-fluoro-4-(4-methylphenyl)spiro[chromene-2,4'-piperidine]-1'-yl]acetic acid?
2-[7-fluoro-4-(4-methylphenyl)spiro[chromene-2,4'-piperidine]-1'-yl]acetic acid has a molecular weight of 367.42 g/mol, XLogP of 3.88, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[7-fluoro-4-(4-methylphenyl)spiro[chromene-2,4'-piperidine]-1'-yl]acetic acid is sourced from PubChem (CID 18770941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).