C23H24N2O4 — CID 18771418
2-[5,8-dimethoxy-3-(4-methoxyphenyl)quinolin-4-yl]oxypentanenitrile (PubChem CID 18771418) has the molecular formula C23H24N2O4 and a molecular weight of 392.46 g/mol. Its IUPAC name is 2-[5,8-dimethoxy-3-(4-methoxyphenyl)quinolin-4-yl]oxypentanenitrile.
| Compound Name | 2-[5,8-dimethoxy-3-(4-methoxyphenyl)quinolin-4-yl]oxypentanenitrile |
|---|---|
| PubChem CID | 18771418 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 2-[5,8-dimethoxy-3-(4-methoxyphenyl)quinolin-4-yl]oxypentanenitrile |
| SMILES | CCCC(C#N)Oc1c(-c2ccc(OC)cc2)cnc2c(OC)ccc(OC)c12 |
| InChI | InChI=1S/C23H24N2O4/c1-5-6-17(13-24)29-23-18(15-7-9-16(26-2)10-8-15)14-25-22-20(28-4)12-11-19(27-3)21(22)23/h7-12,14,17H,5-6H2,1-4H3 |
| InChIKey | UNLISBHPROTSQL-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 73.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |