C20H16FN3S — CID 18771535
4-[2-(4-ethylthiophen-2-yl)-4-(4-fluorophenyl)-1H-imidazol-5-yl]pyridine (PubChem CID 18771535) has the molecular formula C20H16FN3S and a molecular weight of 349.43 g/mol. Its IUPAC name is 4-[2-(4-ethylthiophen-2-yl)-4-(4-fluorophenyl)-1H-imidazol-5-yl]pyridine.
| Compound Name | 4-[2-(4-ethylthiophen-2-yl)-4-(4-fluorophenyl)-1H-imidazol-5-yl]pyridine |
|---|---|
| PubChem CID | 18771535 |
| Molecular Formula | C20H16FN3S |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 4-[2-(4-ethylthiophen-2-yl)-4-(4-fluorophenyl)-1H-imidazol-5-yl]pyridine |
| SMILES | CCc1csc(-c2nc(-c3ccc(F)cc3)c(-c3ccncc3)[nH]2)c1 |
| InChI | InChI=1S/C20H16FN3S/c1-2-13-11-17(25-12-13)20-23-18(14-3-5-16(21)6-4-14)19(24-20)15-7-9-22-10-8-15/h3-12H,2H2,1H3,(H,23,24) |
| InChIKey | SWPPKNUZJCIZOY-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |