C17H15ClFN3 — CID 15429031
4-[2-(3-chloropropyl)-4-(4-fluorophenyl)-1H-imidazol-5-yl]pyridine (PubChem CID 15429031) has the molecular formula C17H15ClFN3 and a molecular weight of 315.78 g/mol. Its IUPAC name is 4-[2-(3-chloropropyl)-4-(4-fluorophenyl)-1H-imidazol-5-yl]pyridine.
| Compound Name | 4-[2-(3-chloropropyl)-4-(4-fluorophenyl)-1H-imidazol-5-yl]pyridine |
|---|---|
| PubChem CID | 15429031 |
| Molecular Formula | C17H15ClFN3 |
| Molecular Weight | 315.78 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 4-[2-(3-chloropropyl)-4-(4-fluorophenyl)-1H-imidazol-5-yl]pyridine |
| SMILES | Fc1ccc(-c2nc(CCCCl)[nH]c2-c2ccncc2)cc1 |
| InChI | InChI=1S/C17H15ClFN3/c18-9-1-2-15-21-16(12-3-5-14(19)6-4-12)17(22-15)13-7-10-20-11-8-13/h3-8,10-11H,1-2,9H2,(H,21,22) |
| InChIKey | RIEOVHLTJLAOOM-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.78 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|