C21H15F2N3O — CID 20692717
(4-fluorophenyl)-[4-(4-fluorophenyl)-5-pyridin-4-yl-1H-imidazol-2-yl]methanol (PubChem CID 20692717) has the molecular formula C21H15F2N3O and a molecular weight of 363.37 g/mol. Its IUPAC name is (4-fluorophenyl)-[4-(4-fluorophenyl)-5-pyridin-4-yl-1H-imidazol-2-yl]methanol.
| Compound Name | (4-fluorophenyl)-[4-(4-fluorophenyl)-5-pyridin-4-yl-1H-imidazol-2-yl]methanol |
|---|---|
| PubChem CID | 20692717 |
| Molecular Formula | C21H15F2N3O |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | (4-fluorophenyl)-[4-(4-fluorophenyl)-5-pyridin-4-yl-1H-imidazol-2-yl]methanol |
| SMILES | OC(c1ccc(F)cc1)c1nc(-c2ccc(F)cc2)c(-c2ccncc2)[nH]1 |
| InChI | InChI=1S/C21H15F2N3O/c22-16-5-1-13(2-6-16)18-19(14-9-11-24-12-10-14)26-21(25-18)20(27)15-3-7-17(23)8-4-15/h1-12,20,27H,(H,25,26) |
| InChIKey | ISVOPEHUXLLLIY-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |