C18H19N5O — CID 18772240
1-[2-amino-3-(1-benzylimidazol-4-yl)propanoyl]-2,5-dihydropyrrole-2-carbonitrile (PubChem CID 18772240) has the molecular formula C18H19N5O and a molecular weight of 321.38 g/mol. Its IUPAC name is 1-[2-amino-3-(1-benzylimidazol-4-yl)propanoyl]-2,5-dihydropyrrole-2-carbonitrile.
| Compound Name | 1-[2-amino-3-(1-benzylimidazol-4-yl)propanoyl]-2,5-dihydropyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 18772240 |
| Molecular Formula | C18H19N5O |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 1-[2-amino-3-(1-benzylimidazol-4-yl)propanoyl]-2,5-dihydropyrrole-2-carbonitrile |
| SMILES | N#CC1C=CCN1C(=O)C(N)Cc1cn(Cc2ccccc2)cn1 |
| InChI | InChI=1S/C18H19N5O/c19-10-16-7-4-8-23(16)18(24)17(20)9-15-12-22(13-21-15)11-14-5-2-1-3-6-14/h1-7,12-13,16-17H,8-9,11,20H2 |
| InChIKey | CJBIRMJFFACPSE-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 87.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|