C14H14FN3O — CID 70014813
(2S)-1-[2-amino-3-(4-fluorophenyl)propanoyl]-2,5-dihydropyrrole-2-carbonitrile (PubChem CID 70014813) has the molecular formula C14H14FN3O and a molecular weight of 259.28 g/mol. Its IUPAC name is (2S)-1-[2-amino-3-(4-fluorophenyl)propanoyl]-2,5-dihydropyrrole-2-carbonitrile.
| Compound Name | (2S)-1-[2-amino-3-(4-fluorophenyl)propanoyl]-2,5-dihydropyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 70014813 |
| Molecular Formula | C14H14FN3O |
| Molecular Weight | 259.28 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | (2S)-1-[2-amino-3-(4-fluorophenyl)propanoyl]-2,5-dihydropyrrole-2-carbonitrile |
| SMILES | N#C[C@@H]1C=CCN1C(=O)C(N)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C14H14FN3O/c15-11-5-3-10(4-6-11)8-13(17)14(19)18-7-1-2-12(18)9-16/h1-6,12-13H,7-8,17H2/t12-,13?/m0/s1 |
| InChIKey | QHZNBBCQODZAIY-UEWDXFNNSA-N |
| XLogP | 0.99 |
| TPSA | 70.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.28 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|