C17H22FN3O2 — CID 141087641
4-[2-amino-3-(4-fluorophenyl)propanoyl]-3-(cyclopropylmethyl)piperazin-2-one (PubChem CID 141087641) has the molecular formula C17H22FN3O2 and a molecular weight of 319.38 g/mol. Its IUPAC name is 4-[2-amino-3-(4-fluorophenyl)propanoyl]-3-(cyclopropylmethyl)piperazin-2-one.
| Compound Name | 4-[2-amino-3-(4-fluorophenyl)propanoyl]-3-(cyclopropylmethyl)piperazin-2-one |
|---|---|
| PubChem CID | 141087641 |
| Molecular Formula | C17H22FN3O2 |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | 4-[2-amino-3-(4-fluorophenyl)propanoyl]-3-(cyclopropylmethyl)piperazin-2-one |
| SMILES | NC(Cc1ccc(F)cc1)C(=O)N1CCNC(=O)C1CC1CC1 |
| InChI | InChI=1S/C17H22FN3O2/c18-13-5-3-11(4-6-13)9-14(19)17(23)21-8-7-20-16(22)15(21)10-12-1-2-12/h3-6,12,14-15H,1-2,7-10,19H2,(H,20,22) |
| InChIKey | PSHXRGCBDRXZAA-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |