C26H30ClNO6 — CID 18774569
N-[bis(3,4-dimethoxyphenyl)methyl]-2-(4-methylphenoxy)acetamide;hydrochloride (PubChem CID 18774569) has the molecular formula C26H30ClNO6 and a molecular weight of 487.98 g/mol. Its IUPAC name is N-[bis(3,4-dimethoxyphenyl)methyl]-2-(4-methylphenoxy)acetamide;hydrochloride.
| Compound Name | N-[bis(3,4-dimethoxyphenyl)methyl]-2-(4-methylphenoxy)acetamide;hydrochloride |
|---|---|
| PubChem CID | 18774569 |
| Molecular Formula | C26H30ClNO6 |
| Molecular Weight | 487.98 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | N-[bis(3,4-dimethoxyphenyl)methyl]-2-(4-methylphenoxy)acetamide;hydrochloride |
| SMILES | COc1ccc(C(NC(=O)COc2ccc(C)cc2)c2ccc(OC)c(OC)c2)cc1OC.Cl |
| InChI | InChI=1S/C26H29NO6.ClH/c1-17-6-10-20(11-7-17)33-16-25(28)27-26(18-8-12-21(29-2)23(14-18)31-4)19-9-13-22(30-3)24(15-19)32-5;/h6-15,26H,16H2,1-5H3,(H,27,28);1H |
| InChIKey | CIRHKUYCPUXKIT-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.98 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |