C20H21ClN2O4S2 — CID 18775394
1-[4-[4-(2-chloro-5-methylsulfanylbenzoyl)piperazin-1-yl]sulfonylphenyl]ethanone (PubChem CID 18775394) has the molecular formula C20H21ClN2O4S2 and a molecular weight of 452.99 g/mol. Its IUPAC name is 1-[4-[4-(2-chloro-5-methylsulfanylbenzoyl)piperazin-1-yl]sulfonylphenyl]ethanone.
| Compound Name | 1-[4-[4-(2-chloro-5-methylsulfanylbenzoyl)piperazin-1-yl]sulfonylphenyl]ethanone |
|---|---|
| PubChem CID | 18775394 |
| Molecular Formula | C20H21ClN2O4S2 |
| Molecular Weight | 452.99 g/mol |
| Exact Mass | 452.06 |
| IUPAC Name | 1-[4-[4-(2-chloro-5-methylsulfanylbenzoyl)piperazin-1-yl]sulfonylphenyl]ethanone |
| SMILES | CSc1ccc(Cl)c(C(=O)N2CCN(S(=O)(=O)c3ccc(C(C)=O)cc3)CC2)c1 |
| InChI | InChI=1S/C20H21ClN2O4S2/c1-14(24)15-3-6-17(7-4-15)29(26,27)23-11-9-22(10-12-23)20(25)18-13-16(28-2)5-8-19(18)21/h3-8,13H,9-12H2,1-2H3 |
| InChIKey | JCAWTPXKGCNWHP-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.99 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |