C21H26N2O3S2 — CID 8624100
(4-methylsulfanylphenyl)-[4-(4-propylphenyl)sulfonylpiperazin-1-yl]methanone (PubChem CID 8624100) has the molecular formula C21H26N2O3S2 and a molecular weight of 418.58 g/mol. Its IUPAC name is (4-methylsulfanylphenyl)-[4-(4-propylphenyl)sulfonylpiperazin-1-yl]methanone.
| Compound Name | (4-methylsulfanylphenyl)-[4-(4-propylphenyl)sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 8624100 |
| Molecular Formula | C21H26N2O3S2 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | (4-methylsulfanylphenyl)-[4-(4-propylphenyl)sulfonylpiperazin-1-yl]methanone |
| SMILES | CCCc1ccc(S(=O)(=O)N2CCN(C(=O)c3ccc(SC)cc3)CC2)cc1 |
| InChI | InChI=1S/C21H26N2O3S2/c1-3-4-17-5-11-20(12-6-17)28(25,26)23-15-13-22(14-16-23)21(24)18-7-9-19(27-2)10-8-18/h5-12H,3-4,13-16H2,1-2H3 |
| InChIKey | PSHPRSXLQCGMRA-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |