C12H13BrN2OS — CID 18775925
(E)-3-(5-bromothiophen-2-yl)-N-butyl-2-cyanoprop-2-enamide (PubChem CID 18775925) has the molecular formula C12H13BrN2OS and a molecular weight of 313.22 g/mol. Its IUPAC name is (E)-3-(5-bromothiophen-2-yl)-N-butyl-2-cyanoprop-2-enamide.
| Compound Name | (E)-3-(5-bromothiophen-2-yl)-N-butyl-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 18775925 |
| Molecular Formula | C12H13BrN2OS |
| Molecular Weight | 313.22 g/mol |
| Exact Mass | 311.99 |
| IUPAC Name | (E)-3-(5-bromothiophen-2-yl)-N-butyl-2-cyanoprop-2-enamide |
| SMILES | CCCCNC(=O)/C(C#N)=C/c1ccc(Br)s1 |
| InChI | InChI=1S/C12H13BrN2OS/c1-2-3-6-15-12(16)9(8-14)7-10-4-5-11(13)17-10/h4-5,7H,2-3,6H2,1H3,(H,15,16)/b9-7+ |
| InChIKey | GEHSMSHFPKVRMB-VQHVLOKHSA-N |
| XLogP | 3.33 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.22 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|