C21H24N4O3S2 — CID 18777630
(E)-3-amino-2-[2-[[4-oxo-3-(oxolan-2-ylmethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]acetyl]but-2-enenitrile (PubChem CID 18777630) has the molecular formula C21H24N4O3S2 and a molecular weight of 444.58 g/mol. Its IUPAC name is (E)-3-amino-2-[2-[[4-oxo-3-(oxolan-2-ylmethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]acetyl]but-2-enenitrile.
| Compound Name | (E)-3-amino-2-[2-[[4-oxo-3-(oxolan-2-ylmethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]acetyl]but-2-enenitrile |
|---|---|
| PubChem CID | 18777630 |
| Molecular Formula | C21H24N4O3S2 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | (E)-3-amino-2-[2-[[4-oxo-3-(oxolan-2-ylmethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]acetyl]but-2-enenitrile |
| SMILES | C/C(N)=C(/C#N)C(=O)CSc1nc2sc3c(c2c(=O)n1CC1CCCO1)CCCC3 |
| InChI | InChI=1S/C21H24N4O3S2/c1-12(23)15(9-22)16(26)11-29-21-24-19-18(14-6-2-3-7-17(14)30-19)20(27)25(21)10-13-5-4-8-28-13/h13H,2-8,10-11,23H2,1H3/b15-12+ |
| InChIKey | KRAOCHZABLYTRH-NTCAYCPXSA-N |
| XLogP | 2.93 |
| TPSA | 111.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|