C19H22N4O3S2 — CID 3939493
3-amino-2-[2-[[3-(2-methoxyethyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]acetyl]but-2-enenitrile (PubChem CID 3939493) has the molecular formula C19H22N4O3S2 and a molecular weight of 418.54 g/mol. Its IUPAC name is 3-amino-2-[2-[[3-(2-methoxyethyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]acetyl]but-2-enenitrile.
| Compound Name | 3-amino-2-[2-[[3-(2-methoxyethyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]acetyl]but-2-enenitrile |
|---|---|
| PubChem CID | 3939493 |
| Molecular Formula | C19H22N4O3S2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | 3-amino-2-[2-[[3-(2-methoxyethyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]acetyl]but-2-enenitrile |
| SMILES | COCCn1c(SCC(=O)C(C#N)=C(C)N)nc2sc3c(c2c1=O)CCCC3 |
| InChI | InChI=1S/C19H22N4O3S2/c1-11(21)13(9-20)14(24)10-27-19-22-17-16(18(25)23(19)7-8-26-2)12-5-3-4-6-15(12)28-17/h3-8,10,21H2,1-2H3 |
| InChIKey | AAVRRZCOLBEJPO-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 111.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|