C23H25N5O — CID 18778279
N-[[2-[(4-methylphenyl)methoxy]naphthalen-1-yl]methyl]-2-propyltetrazol-5-amine (PubChem CID 18778279) has the molecular formula C23H25N5O and a molecular weight of 387.49 g/mol. Its IUPAC name is N-[[2-[(4-methylphenyl)methoxy]naphthalen-1-yl]methyl]-2-propyltetrazol-5-amine.
| Compound Name | N-[[2-[(4-methylphenyl)methoxy]naphthalen-1-yl]methyl]-2-propyltetrazol-5-amine |
|---|---|
| PubChem CID | 18778279 |
| Molecular Formula | C23H25N5O |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | N-[[2-[(4-methylphenyl)methoxy]naphthalen-1-yl]methyl]-2-propyltetrazol-5-amine |
| SMILES | CCCn1nnc(NCc2c(OCc3ccc(C)cc3)ccc3ccccc23)n1 |
| InChI | InChI=1S/C23H25N5O/c1-3-14-28-26-23(25-27-28)24-15-21-20-7-5-4-6-19(20)12-13-22(21)29-16-18-10-8-17(2)9-11-18/h4-13H,3,14-16H2,1-2H3,(H,24,26) |
| InChIKey | ZWLDBEVDNQMWAP-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |