C19H16FN5O — CID 834197
N-[[2-[(4-fluorophenyl)methoxy]naphthalen-1-yl]methyl]-2H-tetrazol-5-amine (PubChem CID 834197) has the molecular formula C19H16FN5O and a molecular weight of 349.37 g/mol. Its IUPAC name is N-[[2-[(4-fluorophenyl)methoxy]naphthalen-1-yl]methyl]-2H-tetrazol-5-amine.
| Compound Name | N-[[2-[(4-fluorophenyl)methoxy]naphthalen-1-yl]methyl]-2H-tetrazol-5-amine |
|---|---|
| PubChem CID | 834197 |
| Molecular Formula | C19H16FN5O |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | N-[[2-[(4-fluorophenyl)methoxy]naphthalen-1-yl]methyl]-2H-tetrazol-5-amine |
| SMILES | Fc1ccc(COc2ccc3ccccc3c2CNc2nn[nH]n2)cc1 |
| InChI | InChI=1S/C19H16FN5O/c20-15-8-5-13(6-9-15)12-26-18-10-7-14-3-1-2-4-16(14)17(18)11-21-19-22-24-25-23-19/h1-10H,11-12H2,(H2,21,22,23,24,25) |
| InChIKey | LYKFBTUJYPLKCA-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |