C20H18BrFO — CID 171486262
1-(3-bromopropyl)-2-[(4-fluorophenyl)methoxy]naphthalene (PubChem CID 171486262) has the molecular formula C20H18BrFO and a molecular weight of 373.27 g/mol. Its IUPAC name is 1-(3-bromopropyl)-2-[(4-fluorophenyl)methoxy]naphthalene.
| Compound Name | 1-(3-bromopropyl)-2-[(4-fluorophenyl)methoxy]naphthalene |
|---|---|
| PubChem CID | 171486262 |
| Molecular Formula | C20H18BrFO |
| Molecular Weight | 373.27 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | 1-(3-bromopropyl)-2-[(4-fluorophenyl)methoxy]naphthalene |
| SMILES | Fc1ccc(COc2ccc3ccccc3c2CCCBr)cc1 |
| InChI | InChI=1S/C20H18BrFO/c21-13-3-6-19-18-5-2-1-4-16(18)9-12-20(19)23-14-15-7-10-17(22)11-8-15/h1-2,4-5,7-12H,3,6,13-14H2 |
| InChIKey | CFYWAJYYCJMPBS-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.27 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|