C14H14ClN5O — CID 18778312
N-[[5-(2-chlorophenyl)furan-2-yl]methyl]-2-ethyltetrazol-5-amine (PubChem CID 18778312) has the molecular formula C14H14ClN5O and a molecular weight of 303.75 g/mol. Its IUPAC name is N-[[5-(2-chlorophenyl)furan-2-yl]methyl]-2-ethyltetrazol-5-amine.
| Compound Name | N-[[5-(2-chlorophenyl)furan-2-yl]methyl]-2-ethyltetrazol-5-amine |
|---|---|
| PubChem CID | 18778312 |
| Molecular Formula | C14H14ClN5O |
| Molecular Weight | 303.75 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | N-[[5-(2-chlorophenyl)furan-2-yl]methyl]-2-ethyltetrazol-5-amine |
| SMILES | CCn1nnc(NCc2ccc(-c3ccccc3Cl)o2)n1 |
| InChI | InChI=1S/C14H14ClN5O/c1-2-20-18-14(17-19-20)16-9-10-7-8-13(21-10)11-5-3-4-6-12(11)15/h3-8H,2,9H2,1H3,(H,16,18) |
| InChIKey | ARBAXEBNOGFVNJ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 68.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.75 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |