C21H25NO4 — CID 18783007
2-[8-[2-(cyclohexanecarbonylamino)ethyl]naphthalen-2-yl]oxyacetic acid (PubChem CID 18783007) has the molecular formula C21H25NO4 and a molecular weight of 355.43 g/mol. Its IUPAC name is 2-[8-[2-(cyclohexanecarbonylamino)ethyl]naphthalen-2-yl]oxyacetic acid.
| Compound Name | 2-[8-[2-(cyclohexanecarbonylamino)ethyl]naphthalen-2-yl]oxyacetic acid |
|---|---|
| PubChem CID | 18783007 |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | 2-[8-[2-(cyclohexanecarbonylamino)ethyl]naphthalen-2-yl]oxyacetic acid |
| SMILES | O=C(O)COc1ccc2cccc(CCNC(=O)C3CCCCC3)c2c1 |
| InChI | InChI=1S/C21H25NO4/c23-20(24)14-26-18-10-9-15-7-4-8-16(19(15)13-18)11-12-22-21(25)17-5-2-1-3-6-17/h4,7-10,13,17H,1-3,5-6,11-12,14H2,(H,22,25)(H,23,24) |
| InChIKey | MPYXXQNFTODNBI-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |