C9H16O2 — CID 18783517
3-methyl-5-propyl-3,6-dihydro-2H-pyran-6-ol (PubChem CID 18783517) has the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. Its IUPAC name is 3-methyl-5-propyl-3,6-dihydro-2H-pyran-6-ol.
| Compound Name | 3-methyl-5-propyl-3,6-dihydro-2H-pyran-6-ol |
|---|---|
| PubChem CID | 18783517 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | 3-methyl-5-propyl-3,6-dihydro-2H-pyran-6-ol |
| SMILES | CCCC1=CC(C)COC1O |
| InChI | InChI=1S/C9H16O2/c1-3-4-8-5-7(2)6-11-9(8)10/h5,7,9-10H,3-4,6H2,1-2H3 |
| InChIKey | RFEPWHRAQSVAIK-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|