About 3-methyl-5-propyl-3,6-dihydro-2H-pyran-6-ol
3-methyl-5-propyl-3,6-dihydro-2H-pyran-6-ol (PubChem CID 18783517) has the molecular formula C9H16O2
and a molecular weight of 156.22 g/mol. Its IUPAC name is 3-methyl-5-propyl-3,6-dihydro-2H-pyran-6-ol.
Molecular Properties
| Compound Name | 3-methyl-5-propyl-3,6-dihydro-2H-pyran-6-ol |
| PubChem CID | 18783517 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | 3-methyl-5-propyl-3,6-dihydro-2H-pyran-6-ol |
| SMILES | CCCC1=CC(C)COC1O |
| InChI | InChI=1S/C9H16O2/c1-3-4-8-5-7(2)6-11-9(8)10/h5,7,9-10H,3-4,6H2,1-2H3 |
| InChIKey | RFEPWHRAQSVAIK-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-5-propyl-3,6-dihydro-2H-pyran-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-5-propyl-3,6-dihydro-2H-pyran-6-ol?
The IUPAC name of 3-methyl-5-propyl-3,6-dihydro-2H-pyran-6-ol (CID 18783517) is 3-methyl-5-propyl-3,6-dihydro-2H-pyran-6-ol.
What is the SMILES notation for 3-methyl-5-propyl-3,6-dihydro-2H-pyran-6-ol?
The canonical SMILES for 3-methyl-5-propyl-3,6-dihydro-2H-pyran-6-ol is CCCC1=CC(C)COC1O.
What is the InChIKey of 3-methyl-5-propyl-3,6-dihydro-2H-pyran-6-ol?
The InChIKey is RFEPWHRAQSVAIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O2/c1-3-4-8-5-7(2)6-11-9(8)10/h5,7,9-10H,3-4,6H2,1-2H3.
What are the key properties of 3-methyl-5-propyl-3,6-dihydro-2H-pyran-6-ol?
3-methyl-5-propyl-3,6-dihydro-2H-pyran-6-ol has a molecular weight of 156.22 g/mol, XLogP of 1.70, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-5-propyl-3,6-dihydro-2H-pyran-6-ol is sourced from PubChem (CID 18783517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).