C7H13NO4 — CID 18427373
N-ethyl-3,4-dihydroxyoxolane-2-carboxamide (PubChem CID 18427373) has the molecular formula C7H13NO4 and a molecular weight of 175.18 g/mol. Its IUPAC name is N-ethyl-3,4-dihydroxyoxolane-2-carboxamide.
| Compound Name | N-ethyl-3,4-dihydroxyoxolane-2-carboxamide |
|---|---|
| PubChem CID | 18427373 |
| Molecular Formula | C7H13NO4 |
| Molecular Weight | 175.18 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | N-ethyl-3,4-dihydroxyoxolane-2-carboxamide |
| SMILES | CCNC(=O)C1OCC(O)C1O |
| InChI | InChI=1S/C7H13NO4/c1-2-8-7(11)6-5(10)4(9)3-12-6/h4-6,9-10H,2-3H2,1H3,(H,8,11) |
| InChIKey | WMSRSBQJMAMVAI-UHFFFAOYSA-N |
| XLogP | -1.76 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.18 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |