C6H11NO6 — CID 173451491
(2S,3S,4R,5S)-N,3,4,5-tetrahydroxyoxane-2-carboxamide (PubChem CID 173451491) has the molecular formula C6H11NO6 and a molecular weight of 193.15 g/mol. Its IUPAC name is (2S,3S,4R,5S)-N,3,4,5-tetrahydroxyoxane-2-carboxamide.
| Compound Name | (2S,3S,4R,5S)-N,3,4,5-tetrahydroxyoxane-2-carboxamide |
|---|---|
| PubChem CID | 173451491 |
| Molecular Formula | C6H11NO6 |
| Molecular Weight | 193.15 g/mol |
| Exact Mass | 193.06 |
| IUPAC Name | (2S,3S,4R,5S)-N,3,4,5-tetrahydroxyoxane-2-carboxamide |
| SMILES | O=C(NO)[C@H]1OC[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H11NO6/c8-2-1-13-5(6(11)7-12)4(10)3(2)9/h2-5,8-10,12H,1H2,(H,7,11)/t2-,3+,4-,5-/m0/s1 |
| InChIKey | PXIIGLBKTZNSMY-QTBDOELSSA-N |
| XLogP | -3.03 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.15 |
| LogP ≤ 5 | -3.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|