C13H16O5 — CID 57066081
2-phenyl-1-[(2S,3S,4R,5S)-3,4,5-trihydroxyoxan-2-yl]ethanone (PubChem CID 57066081) has the molecular formula C13H16O5 and a molecular weight of 252.27 g/mol. Its IUPAC name is 2-phenyl-1-[(2S,3S,4R,5S)-3,4,5-trihydroxyoxan-2-yl]ethanone.
| Compound Name | 2-phenyl-1-[(2S,3S,4R,5S)-3,4,5-trihydroxyoxan-2-yl]ethanone |
|---|---|
| PubChem CID | 57066081 |
| Molecular Formula | C13H16O5 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 2-phenyl-1-[(2S,3S,4R,5S)-3,4,5-trihydroxyoxan-2-yl]ethanone |
| SMILES | O=C(Cc1ccccc1)[C@H]1OC[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H16O5/c14-9(6-8-4-2-1-3-5-8)13-12(17)11(16)10(15)7-18-13/h1-5,10-13,15-17H,6-7H2/t10-,11+,12-,13+/m0/s1 |
| InChIKey | UTPQMJJGDDEPSO-QNWHQSFQSA-N |
| XLogP | -0.72 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |