hydrogen peroxide;sulfurothioic O-acid;sulfurous acid

H6O8S3 — CID 18783594

IUPAChydrogen peroxide;sulfurothioic O-acid;sulfurous acid
SMILESO=S(O)(O)=S.O=S(O)O.OO
InChIInChI=1S/H2O3S2.H2O3S.H2O2/c1-5(2,3)4;1-4(2)3;1-2/h(H2,1,2,3,4);(H2,1,2,3);1-2H
InChIKeyJRECYINBFLAFMR-UHFFFAOYSA-N
MW230.24 g/mol
LogP-0.62
Rot. Bonds

About hydrogen peroxide;sulfurothioic O-acid;sulfurous acid

hydrogen peroxide;sulfurothioic O-acid;sulfurous acid (PubChem CID 18783594) has the molecular formula H6O8S3 and a molecular weight of 230.24 g/mol. Its IUPAC name is hydrogen peroxide;sulfurothioic O-acid;sulfurous acid.

Molecular Properties

Compound Namehydrogen peroxide;sulfurothioic O-acid;sulfurous acid
PubChem CID18783594
Molecular FormulaH6O8S3
Molecular Weight230.24 g/mol
Exact Mass229.92
IUPAC Namehydrogen peroxide;sulfurothioic O-acid;sulfurous acid
SMILESO=S(O)(O)=S.O=S(O)O.OO
InChIInChI=1S/H2O3S2.H2O3S.H2O2/c1-5(2,3)4;1-4(2)3;1-2/h(H2,1,2,3,4);(H2,1,2,3);1-2H
InChIKeyJRECYINBFLAFMR-UHFFFAOYSA-N
XLogP-0.62
TPSA155.52 Ų
H-Bond Donors6
H-Bond Acceptors5
Rotatable Bonds
Heavy Atoms11
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500230.24
LogP ≤ 5-0.62
H-Bond Donors ≤ 56
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}

Analyze hydrogen peroxide;sulfurothioic O-acid;sulfurous acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

silver;sulfurothioic O-acid;sulfurous acid
CID 173330609
bromic acid;sulfurothioic O-acid;sulfurous acid
CID 158337180
iodic acid;sulfurothioic O-acid;sulfurous acid
CID 157272960
sulfuric acid;sulfurous acid
CID 172712432
platinum;sulfurothioic O-acid
CID 173374995
gallane;sulfurothioic O-acid
CID 175433245
sulfurothioic O-acid;uranium
CID 174777711
sulfurothioic O-acid;titanium
CID 174806417
CID 173149311
CID 173149311
sulfamic acid;sulfurous acid
CID 159581131
calcium;hydride;sulfuric acid;sulfurous acid
CID 173085822
azane;sulfane;sulfurothioic O-acid
CID 172705042

Frequently Asked Questions

What is the IUPAC name of hydrogen peroxide;sulfurothioic O-acid;sulfurous acid?
The IUPAC name of hydrogen peroxide;sulfurothioic O-acid;sulfurous acid (CID 18783594) is hydrogen peroxide;sulfurothioic O-acid;sulfurous acid.
What is the SMILES notation for hydrogen peroxide;sulfurothioic O-acid;sulfurous acid?
The canonical SMILES for hydrogen peroxide;sulfurothioic O-acid;sulfurous acid is O=S(O)(O)=S.O=S(O)O.OO.
What is the InChIKey of hydrogen peroxide;sulfurothioic O-acid;sulfurous acid?
The InChIKey is JRECYINBFLAFMR-UHFFFAOYSA-N. The full InChI is InChI=1S/H2O3S2.H2O3S.H2O2/c1-5(2,3)4;1-4(2)3;1-2/h(H2,1,2,3,4);(H2,1,2,3);1-2H.
What are the key properties of hydrogen peroxide;sulfurothioic O-acid;sulfurous acid?
hydrogen peroxide;sulfurothioic O-acid;sulfurous acid has a molecular weight of 230.24 g/mol, XLogP of -0.62, 0 rotatable bonds, 6 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for hydrogen peroxide;sulfurothioic O-acid;sulfurous acid is sourced from PubChem (CID 18783594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).