C20H30N4O3 — CID 18783780
2-[4-[acetyl-[(4-piperazin-1-ylphenyl)methyl]amino]piperidin-1-yl]acetic acid (PubChem CID 18783780) has the molecular formula C20H30N4O3 and a molecular weight of 374.49 g/mol. Its IUPAC name is 2-[4-[acetyl-[(4-piperazin-1-ylphenyl)methyl]amino]piperidin-1-yl]acetic acid.
| Compound Name | 2-[4-[acetyl-[(4-piperazin-1-ylphenyl)methyl]amino]piperidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 18783780 |
| Molecular Formula | C20H30N4O3 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | 2-[4-[acetyl-[(4-piperazin-1-ylphenyl)methyl]amino]piperidin-1-yl]acetic acid |
| SMILES | CC(=O)N(Cc1ccc(N2CCNCC2)cc1)C1CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C20H30N4O3/c1-16(25)24(19-6-10-22(11-7-19)15-20(26)27)14-17-2-4-18(5-3-17)23-12-8-21-9-13-23/h2-5,19,21H,6-15H2,1H3,(H,26,27) |
| InChIKey | HTCQYEFPLXOLEV-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|