C18H26N2O6 — CID 18785288
2-[[2-amino-1-(4-hexoxyphenyl)-2-oxoethyl]-(carboxymethyl)amino]acetic acid (PubChem CID 18785288) has the molecular formula C18H26N2O6 and a molecular weight of 366.41 g/mol. Its IUPAC name is 2-[[2-amino-1-(4-hexoxyphenyl)-2-oxoethyl]-(carboxymethyl)amino]acetic acid.
| Compound Name | 2-[[2-amino-1-(4-hexoxyphenyl)-2-oxoethyl]-(carboxymethyl)amino]acetic acid |
|---|---|
| PubChem CID | 18785288 |
| Molecular Formula | C18H26N2O6 |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 2-[[2-amino-1-(4-hexoxyphenyl)-2-oxoethyl]-(carboxymethyl)amino]acetic acid |
| SMILES | CCCCCCOc1ccc(C(C(N)=O)N(CC(=O)O)CC(=O)O)cc1 |
| InChI | InChI=1S/C18H26N2O6/c1-2-3-4-5-10-26-14-8-6-13(7-9-14)17(18(19)25)20(11-15(21)22)12-16(23)24/h6-9,17H,2-5,10-12H2,1H3,(H2,19,25)(H,21,22)(H,23,24) |
| InChIKey | PDHIYYZGMSVNER-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|