C19H23NO — CID 18785712
1-[1-[(E)-but-2-enyl]-4,5-dimethylpyrrol-2-yl]-3-phenylpropan-1-one (PubChem CID 18785712) has the molecular formula C19H23NO and a molecular weight of 281.40 g/mol. Its IUPAC name is 1-[1-[(E)-but-2-enyl]-4,5-dimethylpyrrol-2-yl]-3-phenylpropan-1-one.
| Compound Name | 1-[1-[(E)-but-2-enyl]-4,5-dimethylpyrrol-2-yl]-3-phenylpropan-1-one |
|---|---|
| PubChem CID | 18785712 |
| Molecular Formula | C19H23NO |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | 1-[1-[(E)-but-2-enyl]-4,5-dimethylpyrrol-2-yl]-3-phenylpropan-1-one |
| SMILES | C/C=C/Cn1c(C(=O)CCc2ccccc2)cc(C)c1C |
| InChI | InChI=1S/C19H23NO/c1-4-5-13-20-16(3)15(2)14-18(20)19(21)12-11-17-9-7-6-8-10-17/h4-10,14H,11-13H2,1-3H3/b5-4+ |
| InChIKey | ASOXQJIUWYXDJN-SNAWJCMRSA-N |
| XLogP | 4.50 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|