C26H31N7O4S — CID 18788277
2-[1-[4-oxo-2-(3-phenylpropanoyl)-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-6-carbonyl]-5-(1,3-thiazole-2-carbonyl)pyrrolidin-3-yl]guanidine (PubChem CID 18788277) has the molecular formula C26H31N7O4S and a molecular weight of 537.65 g/mol. Its IUPAC name is 2-[1-[4-oxo-2-(3-phenylpropanoyl)-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-6-carbonyl]-5-(1,3-thiazole-2-carbonyl)pyrrolidin-3-yl]guanidine.
| Compound Name | 2-[1-[4-oxo-2-(3-phenylpropanoyl)-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-6-carbonyl]-5-(1,3-thiazole-2-carbonyl)pyrrolidin-3-yl]guanidine |
|---|---|
| PubChem CID | 18788277 |
| Molecular Formula | C26H31N7O4S |
| Molecular Weight | 537.65 g/mol |
| Exact Mass | 537.22 |
| IUPAC Name | 2-[1-[4-oxo-2-(3-phenylpropanoyl)-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-6-carbonyl]-5-(1,3-thiazole-2-carbonyl)pyrrolidin-3-yl]guanidine |
| SMILES | NC(N)=NC1CC(C(=O)c2nccs2)N(C(=O)C2CCC3CN(C(=O)CCc4ccccc4)CC(=O)N32)C1 |
| InChI | InChI=1S/C26H31N7O4S/c27-26(28)30-17-12-20(23(36)24-29-10-11-38-24)32(13-17)25(37)19-8-7-18-14-31(15-22(35)33(18)19)21(34)9-6-16-4-2-1-3-5-16/h1-5,10-11,17-20H,6-9,12-15H2,(H4,27,28,30) |
| InChIKey | XPUXYMWUVSJVML-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 155.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.65 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|