C15H18N2O4S — CID 70071903
4-oxo-2-(3-thiophen-3-ylpropanoyl)-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-6-carboxylic acid (PubChem CID 70071903) has the molecular formula C15H18N2O4S and a molecular weight of 322.39 g/mol. Its IUPAC name is 4-oxo-2-(3-thiophen-3-ylpropanoyl)-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-6-carboxylic acid.
| Compound Name | 4-oxo-2-(3-thiophen-3-ylpropanoyl)-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-6-carboxylic acid |
|---|---|
| PubChem CID | 70071903 |
| Molecular Formula | C15H18N2O4S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 4-oxo-2-(3-thiophen-3-ylpropanoyl)-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-6-carboxylic acid |
| SMILES | O=C(O)C1CCC2CN(C(=O)CCc3ccsc3)CC(=O)N21 |
| InChI | InChI=1S/C15H18N2O4S/c18-13(4-1-10-5-6-22-9-10)16-7-11-2-3-12(15(20)21)17(11)14(19)8-16/h5-6,9,11-12H,1-4,7-8H2,(H,20,21) |
| InChIKey | ZTNPESQDSGSOBG-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |