C17H25N3O2S — CID 95299250
(2R)-1-[1-(3-thiophen-3-ylpropanoyl)piperidin-4-yl]pyrrolidine-2-carboxamide (PubChem CID 95299250) has the molecular formula C17H25N3O2S and a molecular weight of 335.47 g/mol. Its IUPAC name is (2R)-1-[1-(3-thiophen-3-ylpropanoyl)piperidin-4-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2R)-1-[1-(3-thiophen-3-ylpropanoyl)piperidin-4-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 95299250 |
| Molecular Formula | C17H25N3O2S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | (2R)-1-[1-(3-thiophen-3-ylpropanoyl)piperidin-4-yl]pyrrolidine-2-carboxamide |
| SMILES | NC(=O)[C@H]1CCCN1C1CCN(C(=O)CCc2ccsc2)CC1 |
| InChI | InChI=1S/C17H25N3O2S/c18-17(22)15-2-1-8-20(15)14-5-9-19(10-6-14)16(21)4-3-13-7-11-23-12-13/h7,11-12,14-15H,1-6,8-10H2,(H2,18,22)/t15-/m1/s1 |
| InChIKey | UJRNGVPZUXCNGL-OAHLLOKOSA-N |
| XLogP | 1.62 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |