C16H22N4O2S — CID 31134867
1-[4-[4-[(1R)-1-hydroxyethyl]triazol-1-yl]piperidin-1-yl]-3-thiophen-3-ylpropan-1-one (PubChem CID 31134867) has the molecular formula C16H22N4O2S and a molecular weight of 334.44 g/mol. Its IUPAC name is 1-[4-[4-[(1R)-1-hydroxyethyl]triazol-1-yl]piperidin-1-yl]-3-thiophen-3-ylpropan-1-one.
| Compound Name | 1-[4-[4-[(1R)-1-hydroxyethyl]triazol-1-yl]piperidin-1-yl]-3-thiophen-3-ylpropan-1-one |
|---|---|
| PubChem CID | 31134867 |
| Molecular Formula | C16H22N4O2S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 1-[4-[4-[(1R)-1-hydroxyethyl]triazol-1-yl]piperidin-1-yl]-3-thiophen-3-ylpropan-1-one |
| SMILES | C[C@@H](O)c1cn(C2CCN(C(=O)CCc3ccsc3)CC2)nn1 |
| InChI | InChI=1S/C16H22N4O2S/c1-12(21)15-10-20(18-17-15)14-4-7-19(8-5-14)16(22)3-2-13-6-9-23-11-13/h6,9-12,14,21H,2-5,7-8H2,1H3/t12-/m1/s1 |
| InChIKey | FRQUNZHTMPHUIA-GFCCVEGCSA-N |
| XLogP | 2.19 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |