About 3,5-dimethyl-4-(1,3-thiazol-4-yl)aniline
3,5-dimethyl-4-(1,3-thiazol-4-yl)aniline (PubChem CID 18788468) has the molecular formula C11H12N2S
and a molecular weight of 204.30 g/mol. Its IUPAC name is 3,5-dimethyl-4-(1,3-thiazol-4-yl)aniline.
Molecular Properties
| Compound Name | 3,5-dimethyl-4-(1,3-thiazol-4-yl)aniline |
| PubChem CID | 18788468 |
| Molecular Formula | C11H12N2S |
| Molecular Weight | 204.30 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | 3,5-dimethyl-4-(1,3-thiazol-4-yl)aniline |
| SMILES | Cc1cc(N)cc(C)c1-c1cscn1 |
| InChI | InChI=1S/C11H12N2S/c1-7-3-9(12)4-8(2)11(7)10-5-14-6-13-10/h3-6H,12H2,1-2H3 |
| InChIKey | ILDOILUUYRNSTK-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.30 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dimethyl-4-(1,3-thiazol-4-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-4-(1,3-thiazol-4-yl)aniline?
The IUPAC name of 3,5-dimethyl-4-(1,3-thiazol-4-yl)aniline (CID 18788468) is 3,5-dimethyl-4-(1,3-thiazol-4-yl)aniline.
What is the SMILES notation for 3,5-dimethyl-4-(1,3-thiazol-4-yl)aniline?
The canonical SMILES for 3,5-dimethyl-4-(1,3-thiazol-4-yl)aniline is Cc1cc(N)cc(C)c1-c1cscn1.
What is the InChIKey of 3,5-dimethyl-4-(1,3-thiazol-4-yl)aniline?
The InChIKey is ILDOILUUYRNSTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2S/c1-7-3-9(12)4-8(2)11(7)10-5-14-6-13-10/h3-6H,12H2,1-2H3.
What are the key properties of 3,5-dimethyl-4-(1,3-thiazol-4-yl)aniline?
3,5-dimethyl-4-(1,3-thiazol-4-yl)aniline has a molecular weight of 204.30 g/mol, XLogP of 3.01, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-4-(1,3-thiazol-4-yl)aniline is sourced from PubChem (CID 18788468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).